Index of /chem/bowen/Publication PDF
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 001.pdf | 2021-09-22 15:39 | 11K | |
![[ ]](/icons/unknown.gif) | 1.4818423.pdf;jsessi..> | 2014-04-22 17:44 | 5.7M | |
| 6-Azauracil.pdf | 2013-12-12 18:54 | 777K | |
| 101.pdf | 2022-01-03 00:02 | 307K | |
| 252SI.pdf | 2020-06-26 01:20 | 15M | |
| 287.pdf | 2019-07-06 19:10 | 1.1M | |
| 288.pdf | 2020-04-15 18:12 | 1.2M | |
| 289.pdf | 2019-12-02 14:11 | 1.5M | |
| 290.pdf | 2019-08-23 15:04 | 639K | |
| 291dipole.pdf | 2019-08-21 14:53 | 1.8M | |
| 292.pdf | 2019-12-02 14:27 | 672K | |
| 293.pdf | 2019-12-02 14:27 | 1.9M | |
| 294-1.pdf | 2020-02-12 15:33 | 3.4M | |
| 294.pdf | 2019-10-02 16:17 | 1.9M | |
| 295.pdf | 2020-02-12 15:29 | 2.4M | |
| 296.pdf | 2020-08-04 20:48 | 1.4M | |
| 297.pdf | 2020-08-04 20:43 | 699K | |
| 297a.pdf | 2020-08-04 20:38 | 2.0M | |
| 298.pdf | 2021-01-19 21:15 | 1.0M | |
| 299.pdf | 2021-01-19 21:03 | 1.3M | |
| 300.pdf | 2021-01-19 20:59 | 433K | |
| 301.pdf | 2021-03-03 18:58 | 3.5M | |
| 302.pdf | 2021-03-03 19:02 | 1.3M | |
| 303.pdf | 2021-03-18 19:53 | 1.6M | |
| 304.pdf | 2021-03-18 19:45 | 1.7M | |
| 305.pdf | 2021-04-30 21:37 | 3.0M | |
| 306.pdf | 2023-02-10 21:26 | 2.4M | |
| 307.pdf | 2021-06-12 20:41 | 2.9M | |
| 308.pdf | 2021-06-12 20:18 | 4.8M | |
| 309.pdf | 2021-06-23 20:45 | 1.0M | |
| 310.pdf | 2021-07-21 18:48 | 3.0M | |
| 311.pdf | 2023-02-10 21:24 | 2.2M | |
| 312.pdf | 2021-08-22 22:34 | 1.4M | |
| 313.pdf | 2023-02-10 21:21 | 1.9M | |
| 314.pdf | 2023-02-10 21:18 | 1.3M | |
| 315.pdf | 2021-10-01 18:14 | 5.7M | |
| 316.pdf | 2023-02-10 21:15 | 1.8M | |
| 317.pdf | 2021-10-25 01:53 | 2.1M | |
| 318.pdf | 2022-01-26 16:59 | 1.4M | |
| 319.pdf | 2022-02-04 16:03 | 4.8M | |
| 320.pdf | 2023-02-10 21:12 | 1.5M | |
| 321.pdf | 2023-02-10 21:10 | 2.3M | |
| 322.pdf | 2022-05-23 19:57 | 932K | |
| 323.pdf | 2022-10-05 18:11 | 3.5M | |
| 324.pdf | 2023-02-10 21:06 | 1.7M | |
| 325.pdf | 2023-02-10 21:04 | 4.0M | |
| 326.pdf | 2022-05-30 16:51 | 1.3M | |
| 327.pdf | 2023-02-10 21:02 | 4.0M | |
| 328.pdf | 2023-02-10 21:00 | 5.8M | |
| 329.pdf | 2023-02-10 20:58 | 5.7M | |
| 330.pdf | 2023-01-11 15:55 | 2.2M | |
| 331.pdf | 2023-02-10 20:50 | 2.6M | |
| 332.pdf | 2023-08-31 19:35 | 2.6M | |
| 333.pdf | 2023-08-31 19:45 | 4.3M | |
| 334.pdf | 2023-08-31 19:42 | 10M | |
| 335.pdf | 2024-08-13 16:12 | 3.0M | |
| ALnHM.pdf | 2016-08-22 18:48 | 1.2M | |
| AT Base Pair Anions ..> | 2009-05-08 21:39 | 436K | |
| A baby crystal.pdf | 2012-01-18 19:22 | 2.2M | |
| Acetylproline.pdf | 2011-09-15 16:32 | 1.2M | |
| Adiabatically bound ..> | 2009-05-15 19:48 | 275K | |
| AgAuAlloy.pdf | 2018-09-26 20:11 | 940K | |
| Al4(PtBu2)6.pdf | 2009-05-08 21:39 | 962K | |
| Al13H.pdf | 2009-10-23 17:27 | 335K | |
| Al13X.pdf | 2010-09-26 20:23 | 808K | |
| AlCp.pdf | 2018-08-01 16:12 | 2.0M | |
| AlH3.pdf | 2012-10-02 18:31 | 852K | |
| AlH4.pdf | 2014-02-25 18:41 | 585K | |
| AlHBH.pdf | 2016-06-29 17:49 | 811K | |
| Al_triplebond.pdf | 2018-11-28 15:53 | 1.0M | |
| Albpy.pdf | 2016-04-05 18:42 | 2.5M | |
| Al hydride cluster c..> | 2016-10-18 03:42 | 1.1M | |
| Al triple bond.pdf | 2018-08-21 13:24 | 900K | |
| Aluminium amidinates..> | 2013-10-09 19:57 | 769K | |
| Alx.pdf | 2014-04-08 18:59 | 1.1M | |
| Ammonia-HBr.pdf | 2010-01-25 15:37 | 1.2M | |
| Ammonia cluster anio..> | 2009-05-08 21:39 | 82K | |
| Anion photoelectron ..> | 2009-05-08 21:39 | 155K | |
| Anion solvation at t..> | 2009-05-08 21:39 | 186K | |
| As.pdf | 2012-03-17 14:51 | 121K | |
| AsO.pdf | 2012-03-17 14:51 | 92K | |
| AuOH.pdf | 2015-05-13 02:42 | 748K | |
| Au_TiO2.pdf | 2014-04-08 19:03 | 2.2M | |
| AunRhm.pdf | 2015-05-13 02:40 | 2.3M | |
| Azabenzene.pdf | 2016-09-20 03:46 | 2.1M | |
| B Al surface.pdf | 2017-07-21 18:09 | 1.8M | |
| Barrier-free intermo..> | 2009-05-08 21:39 | 506K | |
| Barrier-free intermo..> | 2009-05-08 21:39 | 1.7M | |
| Barrier-free proton ..> | 2009-05-08 21:39 | 703K | |
| Boron cluster anions..> | 2009-05-08 21:39 | 171K | |
| Bound anionic states..> | 2009-05-08 21:39 | 564K | |
| CO2_Activation.pdf | 2019-05-29 18:30 | 2.3M | |
| Carbon Aluminum Hydr..> | 2016-10-21 13:45 | 1.5M | |
| Characterization of ..> | 2009-05-08 21:39 | 298K | |
| Chemiluminescence.pdf | 2009-05-08 21:39 | 168K | |
| Chiral Clusters.pdf | 2013-09-17 15:48 | 966K | |
| Closo-alanes (Al4H4,..> | 2009-05-08 21:39 | 292K | |
| Clusters Structure, ..> | 2009-05-08 21:39 | 1.1M | |
| Co(Pyridine).pdf | 2015-11-13 16:52 | 1.1M | |
| Co6S8.pdf | 2018-12-08 18:54 | 831K | |
| Co6S8_SI.pdf | 2018-12-21 15:51 | 464K | |
| Cobalt-benzene clust..> | 2009-05-08 21:39 | 98K | |
| Comment.pdf | 2009-05-08 21:39 | 2.6M | |
| CpAlnH.pdf | 2016-09-09 16:03 | 2.7M | |
| Cu-Asp.pdf | 2010-08-25 14:08 | 1.9M | |
| CuCl.pdf | 2011-12-30 16:57 | 1.2M | |
| Cu_dithiol.pdf | 2018-02-15 22:04 | 3.0M | |
| D2O6.pdf | 2009-05-08 21:39 | 149K | |
| DMMP_(MoO3)3.pdf | 2018-02-14 15:30 | 3.5M | |
| Deprotonated Ferroce..> | 2013-12-06 15:59 | 859K | |
| Designer Halogen Bon..> | 2017-05-03 23:55 | 723K | |
| Development of an In..> | 2012-03-28 13:59 | 296K | |
| Diphenylphosphide An..> | 2014-04-08 19:01 | 829K | |
| Dipole-Bound Anions.pdf | 2018-05-09 13:54 | 1.8M | |
| Dipole-bound anions ..> | 2009-05-08 21:39 | 166K | |
| Dipole-bound anions ..> | 2009-05-08 21:39 | 166K | |
| Dipole bound, nuclei..> | 2009-05-08 21:39 | 59K | |
| Double Rydberg anion..> | 2009-05-08 21:39 | 79K | |
| EIPT_NC.pdf | 2019-03-15 16:41 | 1.0M | |
| Electric deflection ..> | 2009-05-08 21:39 | 209K | |
| Electric dipole mome..> | 2009-05-08 21:39 | 166K | |
| Electron-Driven Acid..> | 2009-05-08 21:39 | 253K | |
| Electron Attachment ..> | 2009-05-08 21:39 | 1.1M | |
| Electron attachment ..> | 2009-05-08 21:39 | 543K | |
| Electron attachment ..> | 2009-05-08 21:39 | 1.1M | |
| Electron binding to ..> | 2009-05-08 21:39 | 104K | |
| Electronic Structure..> | 2009-05-08 21:39 | 113K | |
| ElectronicTransmutat..> | 2018-08-01 15:54 | 2.8M | |
| Electronic and geome..> | 2009-05-08 21:39 | 865K | |
| Electronic propertie..> | 2009-05-08 21:39 | 119K | |
| Electron transfer co..> | 2009-05-08 21:39 | 375K | |
| Electrophilic proper..> | 2009-05-08 21:39 | 621K | |
| Ethyl Cyanoacrylate ..> | 2013-09-01 22:35 | 547K | |
| Excess Electron Atta..> | 2009-05-08 21:39 | 122K | |
| Excess Electron Atta..> | 2009-05-08 21:39 | 270K | |
| Fermi.pdf | 2009-05-15 19:51 | 2.1M | |
| GaN.pdf | 2010-10-27 14:41 | 1.1M | |
| Glutathione.pdf | 2009-12-17 14:53 | 198K | |
| Grignard.pdf | 2016-04-05 18:35 | 419K | |
| Ground state structu..> | 2009-05-08 21:39 | 645K | |
| Ground state structu..> | 2009-05-08 21:39 | 645K | |
| HBE.pdf | 2019-08-21 14:50 | 1.4M | |
| Halogen Bonds.pdf | 2017-03-30 01:39 | 575K | |
| Halouracils.pdf | 2011-01-03 22:44 | 149K | |
| Heteroborane analogs..> | 2009-05-08 21:39 | 347K | |
| Heteroborane analogs..> | 2009-05-08 21:39 | 347K | |
| Homogeneous NAB dime..> | 2010-03-24 22:36 | 1.3M | |
| Hydrated nucleoside.pdf | 2010-10-08 22:03 | 240K | |
| Hydrogenated Planar ..> | 2017-05-08 16:31 | 3.0M | |
| Indo-US paper_Nova_1..> | 2009-06-18 19:30 | 2.6M | |
| In search of theoret..> | 2009-05-08 21:39 | 74K | |
| Intermolecular Proto..> | 2009-05-08 21:39 | 328K | |
| Intermolecular proto..> | 2009-05-08 21:39 | 366K | |
| Intrinsic electrophi..> | 2009-05-08 21:39 | 181K | |
| Iron pyrene.pdf | 2011-11-23 20:57 | 1.8M | |
| Israel J Chem.pdf | 2012-10-13 01:52 | 2.6M | |
| JChemPhys_134_054318..> | 2011-02-10 14:53 | 281K | |
| LAlH- and LAln-.pdf | 2017-06-14 15:10 | 2.3M | |
| La.pdf | 2015-11-13 18:49 | 2.8M | |
| Li2.pdf | 2012-10-13 01:56 | 491K | |
| Li2Al3H8.pdf | 2015-09-03 14:45 | 1.1M | |
| Li3O.pdf | 2011-11-07 15:17 | 1.0M | |
| Lin- paper JChemPhy..> | 2011-02-07 18:15 | 383K | |
| Lithium Dimer.pdf | 2009-05-15 19:51 | 420K | |
| Long-Range Electron ..> | 2009-05-08 21:39 | 749K | |
| Long-range electron ..> | 2009-05-08 21:39 | 749K | |
| Low-Energy-Barries P..> | 2010-03-17 00:26 | 358K | |
| Low-Overpotential El..> | 2017-06-05 17:51 | 2.6M | |
| Low Barrier Hydrogen..> | 2014-01-06 22:59 | 308K | |
| Low lying electronic..> | 2009-05-08 21:39 | 136K | |
| Lundell_et_al-2017-A..> | 2018-05-09 15:33 | 1.5M | |
| MAMT-FA.pdf | 2010-08-29 16:35 | 3.9M | |
| MAMTFA.pdf | 2010-08-13 14:37 | 3.9M | |
| MCFA-iFirst.pdf | 2010-10-12 19:35 | 1.0M | |
| MCFA.pdf | 2010-11-10 01:12 | 1.0M | |
| MCO2.pdf | 2015-11-13 16:54 | 1.5M | |
| Magic Rule Reply.pdf | 2009-05-08 21:39 | 35K | |
| Magic Rule for AlnHm..> | 2009-05-08 21:39 | 310K | |
| Magic Rule for AlnHm..> | 2009-05-08 21:39 | 35K | |
| Magic numbers in Al...> | 2009-05-08 21:39 | 115K | |
| Magic numbers in cop..> | 2009-05-08 21:39 | 85K | |
| Magic rule for Al(n)..> | 2009-05-08 21:39 | 310K | |
| Magnetic isomers and..> | 2009-05-08 21:39 | 460K | |
| Mass Spectrometric a..> | 2009-05-08 21:39 | 325K | |
| Measurement of the X..> | 2009-05-08 21:39 | 424K | |
| Measurement of the X..> | 2009-05-08 21:39 | 424K | |
| Metal−Boron Bondin..> | 2018-01-19 14:45 | 2.2M | |
| Metal Boron Bonding.pdf | 2018-01-19 14:51 | 2.2M | |
| MgAl.pdf | 2014-04-15 14:44 | 1.6M | |
| MgH.pdf | 2014-06-09 19:31 | 398K | |
| MgO.pdf | 2014-01-20 17:09 | 1.6M | |
| Microsolvation of sm..> | 2009-05-08 21:39 | 135K | |
| Microwave and radio ..> | 2009-05-08 21:39 | 338K | |
| Mn.pdf | 2015-10-27 13:57 | 5.9M | |
| MnCl.pdf | 2011-03-11 18:52 | 346K | |
| MnO.pdf | 2012-04-05 14:31 | 685K | |
| Mnn- clusters Size-i..> | 2009-05-08 21:39 | 253K | |
| MoO3 and WO3.pdf | 2012-05-08 17:33 | 1.5M | |
| Mo_STM.pdf | 2014-03-12 17:40 | 684K | |
| NEGATIVE ION, PHOTOE..> | 2009-05-08 21:39 | 338K | |
| NaAl.pdf | 2014-02-03 17:38 | 2.5M | |
| NaBH3.pdf | 2019-07-25 21:27 | 1.0M | |
| NaSn.pdf | 2011-06-14 13:45 | 581K | |
| Nanoclusters Their G..> | 2009-06-11 23:11 | 630K | |
| Negative Ion Photoel..> | 2009-05-08 21:39 | 659K | |
| Negative Ion Photoel..> | 2009-05-08 21:39 | 683K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 427K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 344K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 505K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 97K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 499K | |
| Negative ion photoel..> | 2009-05-08 21:39 | 219K | |
| Negative ions of nit..> | 2009-05-08 21:39 | 417K | |
| Nondissociative Elec..> | 2009-05-08 21:39 | 113K | |
| Onset of metallic be..> | 2009-05-08 21:39 | 108K | |
| On the binding of el..> | 2009-05-08 21:39 | 132K | |
| On the interaction o..> | 2009-05-08 21:39 | 73K | |
| On the origin of the..> | 2009-05-08 21:39 | 377K | |
| On the photodetachme..> | 2009-05-08 21:39 | 308K | |
| PbS.pdf | 2011-10-09 16:08 | 2.8M | |
| PdH3.pdf | 2015-09-04 18:29 | 2.9M | |
| Ph2COAl.pdf | 2016-07-11 19:20 | 750K | |
| Phenol.pdf | 2015-09-02 15:36 | 1.0M | |
| Phosphanide.pdf | 2013-11-20 18:27 | 167K | |
| Photodetachment Spec..> | 2012-10-11 23:08 | 571K | |
| Photodetachment Spec..> | 2012-10-12 16:43 | 4.5M | |
| Photodetachment spec..> | 2009-05-15 19:51 | 1.4M | |
| Photoelectron Spectr..> | 2009-08-13 14:02 | 1.1M | |
| Photoelectron Spectr..> | 2009-06-11 23:11 | 2.6M | |
| Photoelectron Spectr..> | 2009-06-15 15:10 | 3.3M | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 174K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 327K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 243K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 765K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 765K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 278K | |
| Photoelectron spectr..> | 2009-05-15 19:51 | 240K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 778K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 778K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 83K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 83K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 172K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 87K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 61K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 186K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 318K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 252K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 339K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 133K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 627K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 65K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 84K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 762K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 100K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 1.0M | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 271K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 929K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 171K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 168K | |
| Photoelectron spectr..> | 2009-05-15 19:52 | 491K | |
| Phys and Chem of Fin..> | 2009-05-15 19:52 | 1.0M | |
| Polymeric structures..> | 2010-06-28 18:05 | 478K | |
| Prediction and obser..> | 2009-05-15 19:52 | 691K | |
| Primary Reaction Ste..> | 2009-05-15 19:52 | 267K | |
| Proceedings of NATO.pdf | 2009-05-15 19:52 | 680K | |
| PtAl.pdf | 2014-04-30 18:27 | 429K | |
| PtCl.pdf | 2012-05-18 13:50 | 1.2M | |
| PtHCO2.pdf | 2016-07-11 19:24 | 1.0M | |
| PtMgH3,5-.pdf | 2016-09-15 00:30 | 1.8M | |
| PtMgH3,5.pdf | 2016-07-11 19:15 | 1.8M | |
| PtPb.pdf | 2011-08-30 13:58 | 702K | |
| PtZnH5.pdf | 2014-04-18 20:13 | 1.2M | |
| Pt_H2O_SI.pdf | 2018-12-20 16:59 | 1.3M | |
| Pyrimidine.pdf | 2015-02-04 14:24 | 796K | |
| RET.pdf | 2018-08-07 20:37 | 2.6M | |
| RGD.pdf | 2009-06-08 14:54 | 217K | |
| Radicals formed in N..> | 2011-12-09 20:54 | 3.1M | |
| RhCo.pdf | 2011-04-25 16:46 | 1.1M | |
| Rhn.pdf | 2013-03-25 19:46 | 337K | |
| Role of Water in Ele..> | 2009-05-15 19:52 | 445K | |
| SI256.pdf | 2018-12-21 18:41 | 828K | |
| SI257.pdf | 2018-12-21 18:39 | 1.7M | |
| SI259.pdf | 2018-12-21 18:36 | 1.3M | |
| SI260.pdf | 2018-12-21 18:35 | 12M | |
| SI261.pdf | 2018-12-21 18:33 | 592K | |
| SI262.pdf | 2018-12-21 18:30 | 288K | |
| SI263.pdf | 2018-12-21 18:28 | 1.9M | |
| SI265.pdf | 2018-12-21 18:25 | 768K | |
| SI267.pdf | 2018-12-21 18:13 | 316K | |
| SI269.pdf | 2018-12-21 18:10 | 206K | |
| SI270.pdf | 2018-12-21 18:01 | 605K | |
| SI272.pdf | 2018-12-21 17:57 | 170K | |
| SI274.pdf | 2018-12-21 17:51 | 699K | |
| SI275.pdf | 2018-12-21 16:05 | 310K | |
| SI276.pdf | 2018-12-21 16:03 | 701K | |
| SI277.pdf | 2018-12-21 15:57 | 687K | |
| SI281.pdf | 2019-03-15 16:45 | 337K | |
| SI282.pdf | 2019-06-03 03:42 | 419K | |
| Sb@[email protected] | 2017-03-05 23:27 | 1.4M | |
| Selective etching.pdf | 2009-11-20 16:14 | 476K | |
| SmB6 Cluster Anion.pdf | 2017-05-08 16:43 | 2.1M | |
| Solvated Electrons i..> | 2009-05-15 19:52 | 148K | |
| Solvated electrons i..> | 2009-05-15 19:52 | 148K | |
| Solvent-induced stab..> | 2009-05-15 19:52 | 82K | |
| Spectroscopic signat..> | 2009-05-15 19:52 | 221K | |
| Spin Conservation Ac..> | 2009-05-15 19:52 | 212K | |
| Stable Valence Anion..> | 2009-05-15 19:52 | 2.0M | |
| Structure and stabil..> | 2009-05-15 19:52 | 322K | |
| Structure and stabil..> | 2009-05-15 19:52 | 322K | |
| Studies of protonate..> | 2009-05-15 19:53 | 272K | |
| Substituted Uracil.pdf | 2013-09-12 20:37 | 1.7M | |
| Surface Morphologies..> | 2011-06-09 00:42 | 4.0M | |
| TaO.pdf | 2012-03-17 14:51 | 204K | |
| Ta anions.pdf | 2015-02-04 14:15 | 755K | |
| Tang_et_al-2018-Chem..> | 2018-05-09 16:13 | 1.6M | |
| Tetrabromidobis.pdf | 2012-09-17 14:01 | 243K | |
| Tetrakis.pdf | 2009-11-05 22:54 | 332K | |
| The Generation and O..> | 2009-06-11 23:11 | 780K | |
| The Smoke-Ion Source..> | 2009-06-12 18:57 | 4.8M | |
| The Smoke Ion Source..> | 2009-06-15 15:43 | 1.9M | |
| The chlorination.pdf | 2009-08-13 14:02 | 228K | |
| The chlorination of ..> | 2009-05-08 21:39 | 228K | |
| The dipole bound-to-..> | 2009-05-15 19:53 | 59K | |
| The ionic KAl13 mole..> | 2009-05-15 19:53 | 130K | |
| The negative ion pho..> | 2009-05-15 19:53 | 642K | |
| Thermal desorption o..> | 2017-03-05 23:27 | 1.9M | |
| The stabilization of..> | 2009-05-15 19:53 | 40K | |
| Thiouracil.pdf | 2011-02-19 20:42 | 115K | |
| Thymidine.pdf | 2012-12-05 16:23 | 337K | |
| Two new double Rydbe..> | 2009-05-15 19:53 | 86K | |
| Unexpected Stability..> | 2009-05-15 19:53 | 171K | |
| Using cluster studie..> | 2009-05-15 19:53 | 178K | |
| VNa.pdf | 2013-09-25 22:23 | 1.9M | |
| Valence Anions in Co..> | 2009-05-15 19:53 | 284K | |
| Valence Anions of 9M..> | 2009-05-15 19:53 | 681K | |
| Vibrationally Resolv..> | 2009-05-15 19:53 | 164K | |
| Vibronic effects in ..> | 2009-05-15 19:53 | 161K | |
| WO3.pdf | 2015-02-04 14:23 | 3.9M | |
| Weakly bound complex..> | 2009-05-15 19:53 | 423K | |
| Zhang_et_al-2016-Ang..> | 2017-03-18 19:00 | 1.2M | |
| Zhang_et_al-2017-Che..> | 2017-03-30 01:31 | 575K | |
| Zinc oxide and its a..> | 2009-05-15 19:53 | 106K | |
| Z phys D 20.pdf | 2012-10-13 01:32 | 542K | |
| Z phys D 26.pdf | 2012-10-13 01:36 | 691K | |
| Z phys D 29.pdf | 2012-10-13 01:40 | 491K | |
| ZrO,HfO,HfHO,HfO2H.pdf | 2012-04-17 17:17 | 414K | |
| Zwitterion formation..> | 2009-05-15 19:53 | 77K | |
| air sensitive alumin..> | 2016-09-09 18:27 | 1.0M | |
| alane.pdf | 2013-03-25 17:32 | 537K | |
| alnmo.pdf | 2019-07-29 00:55 | 3.6M | |
| benzaldehyde.pdf | 2014-06-09 19:26 | 855K | |
| boron aluminum hydri..> | 2014-04-30 16:42 | 1.7M | |
| cetoacetic Acid.pdf | 2015-10-26 14:14 | 842K | |
| chloroaniline.pdf | 2019-04-30 19:46 | 1.0M | |
| clusters on surfaces..> | 2013-06-19 15:37 | 2.1M | |
| cobalt sulfide.pdf | 2019-02-06 22:07 | 769K | |
| dT.pdf | 2016-07-11 19:28 | 2.0M | |
| deoxycytidine.pdf | 2013-09-01 22:33 | 1.3M | |
| dialumane.pdf | 2014-12-14 23:30 | 774K | |
| dipolebond_RET.pdf | 2018-11-28 15:53 | 936K | |
| electronic shells in..> | 2009-05-15 19:51 | 607K | |
| encyclopedia of mass..> | 2009-05-15 19:51 | 2.5M | |
| energetic materials.pdf | 2012-11-09 18:58 | 888K | |
| enz_cal.pdf | 2017-08-29 19:49 | 937K | |
| gold py.pdf | 2017-08-29 19:46 | 2.0M | |
| growmode.pdf | 2015-05-15 18:19 | 1.6M | |
| hydroxylamine_Au.pdf | 2018-12-02 14:19 | 1.0M | |
| indole(H2O).pdf | 2016-09-09 19:06 | 3.2M | |
| indole(H2O)1,2−.pdf | 2016-07-11 19:14 | 3.2M | |
| iron porphyrin.pdf | 2015-10-26 14:08 | 456K | |
| jerusalem symposium.pdf | 2009-05-15 19:51 | 937K | |
| methane_Pt.pdf | 2019-06-03 03:39 | 1.2M | |
| methane_activation_P..> | 2019-04-11 18:43 | 1.1M | |
| molecular aluminum.pdf | 2016-04-05 18:34 | 9.8M | |
| nheterocycle co2.pdf | 2017-04-04 20:59 | 4.2M | |
| ntrinsic electrophil..> | 2009-05-08 21:39 | 181K | |
| odicarbadodecaborane..> | 2016-06-15 14:35 | 932K | |
| oxalic_acid.pdf | 2017-11-15 16:20 | 2.3M | |
| oxalic acid.pdf | 2014-06-16 15:59 | 764K | |
| p-nitroaniline.pdf | 2013-06-19 17:05 | 939K | |
| paranitrophenylsulfo..> | 2013-12-17 16:05 | 1.4M | |
| pes of clusters.pdf | 2009-05-15 19:51 | 2.8M | |
| quinoline.pdf | 2015-02-04 14:19 | 210K | |
| quinoline_CO2.pdf | 2015-07-07 21:08 | 1.6M | |
| self-assembly-WO3.pdf | 2018-05-09 15:42 | 5.8M | |
| solvated electron cl..> | 2009-05-15 19:52 | 1.0M | |
| stabilizing otherwis..> | 2017-08-02 17:50 | 1.0M | |
| structure of small m..> | 2009-05-15 19:53 | 1.6M | |
| tetrafluoroazobenzen..> | 2015-10-27 14:01 | 1.6M | |
| uridine homodimer ra..> | 2012-11-27 23:20 | 1.1M | |
| water_splitting.pdf | 2018-12-10 23:01 | 1.1M | |
|
|---|